C26H33N5O4S — CID 59078783
(3Z)-5-[dihydroxy-[(E)-4-isocyanobut-2-enyl]-λ4-sulfanyl]-3-[[3,5-dimethyl-4-(4-methylpiperazine-1-carbonyl)-1H-pyrrol-2-yl]methylidene]-5,6-dihydro-1H-indol-2-one (PubChem CID 59078783) has the molecular formula C26H33N5O4S and a molecular weight of 511.65 g/mol. Its IUPAC name is (3Z)-5-[dihydroxy-[(E)-4-isocyanobut-2-enyl]-λ4-sulfanyl]-3-[[3,5-dimethyl-4-(4-methylpiperazine-1-carbonyl)-1H-pyrrol-2-yl]methylidene]-5,6-dihydro-1H-indol-2-one.
| Compound Name | (3Z)-5-[dihydroxy-[(E)-4-isocyanobut-2-enyl]-λ4-sulfanyl]-3-[[3,5-dimethyl-4-(4-methylpiperazine-1-carbonyl)-1H-pyrrol-2-yl]methylidene]-5,6-dihydro-1H-indol-2-one |
|---|---|
| PubChem CID | 59078783 |
| Molecular Formula | C26H33N5O4S |
| Molecular Weight | 511.65 g/mol |
| Exact Mass | 511.23 |
| IUPAC Name | (3Z)-5-[dihydroxy-[(E)-4-isocyanobut-2-enyl]-λ4-sulfanyl]-3-[[3,5-dimethyl-4-(4-methylpiperazine-1-carbonyl)-1H-pyrrol-2-yl]methylidene]-5,6-dihydro-1H-indol-2-one |
| SMILES | [C-]#[N+]C/C=C/CS(O)(O)C1C=C2C(=CC1)NC(=O)/C2=C\c1[nH]c(C)c(C(=O)N2CCN(C)CC2)c1C |
| InChI | InChI=1S/C26H33N5O4S/c1-17-23(28-18(2)24(17)26(33)31-12-10-30(4)11-13-31)16-21-20-15-19(7-8-22(20)29-25(21)32)36(34,35)14-6-5-9-27-3/h5-6,8,15-16,19,28,34-35H,7,9-14H2,1-2,4H3,(H,29,32)/b6-5+,21-16- |
| InChIKey | ZAHDSKTVGNBQCO-JRSZRZAWSA-N |
| XLogP | 3.34 |
| TPSA | 113.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.65 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|