About N-ethyl-N-(pyrrolidin-1-ium-1-ylidenemethyl)ethanamine;uranium(2+)
N-ethyl-N-(pyrrolidin-1-ium-1-ylidenemethyl)ethanamine;uranium(2+) (PubChem CID 59079049) has the molecular formula C9H17N2U+
and a molecular weight of 391.28 g/mol. Its IUPAC name is N-ethyl-N-(pyrrolidin-1-ium-1-ylidenemethyl)ethanamine;uranium(2+).
Molecular Properties
| Compound Name | N-ethyl-N-(pyrrolidin-1-ium-1-ylidenemethyl)ethanamine;uranium(2+) |
| PubChem CID | 59079049 |
| Molecular Formula | C9H17N2U+ |
| Molecular Weight | 391.28 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | N-ethyl-N-(pyrrolidin-1-ium-1-ylidenemethyl)ethanamine;uranium(2+) |
| SMILES | [CH2-]CN(C=[N+]1CCCC1)C[CH2-].[U+2] |
| InChI | InChI=1S/C9H17N2.U/c1-3-10(4-2)9-11-7-5-6-8-11;/h9H,1-8H2;/q-1;+2 |
| InChIKey | QHMHTKSUNNKCLN-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.28 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N-(pyrrolidin-1-ium-1-ylidenemethyl)ethanamine;uranium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-(pyrrolidin-1-ium-1-ylidenemethyl)ethanamine;uranium(2+)?
The IUPAC name of N-ethyl-N-(pyrrolidin-1-ium-1-ylidenemethyl)ethanamine;uranium(2+) (CID 59079049) is N-ethyl-N-(pyrrolidin-1-ium-1-ylidenemethyl)ethanamine;uranium(2+).
What is the SMILES notation for N-ethyl-N-(pyrrolidin-1-ium-1-ylidenemethyl)ethanamine;uranium(2+)?
The canonical SMILES for N-ethyl-N-(pyrrolidin-1-ium-1-ylidenemethyl)ethanamine;uranium(2+) is [CH2-]CN(C=[N+]1CCCC1)C[CH2-].[U+2].
What is the InChIKey of N-ethyl-N-(pyrrolidin-1-ium-1-ylidenemethyl)ethanamine;uranium(2+)?
The InChIKey is QHMHTKSUNNKCLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N2.U/c1-3-10(4-2)9-11-7-5-6-8-11;/h9H,1-8H2;/q-1;+2.
What are the key properties of N-ethyl-N-(pyrrolidin-1-ium-1-ylidenemethyl)ethanamine;uranium(2+)?
N-ethyl-N-(pyrrolidin-1-ium-1-ylidenemethyl)ethanamine;uranium(2+) has a molecular weight of 391.28 g/mol, XLogP of 0.79, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-(pyrrolidin-1-ium-1-ylidenemethyl)ethanamine;uranium(2+) is sourced from PubChem (CID 59079049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).