C12H10N2O4S — CID 59079460
4'-Nitro[1,1'-biphenyl]-4-sulfonamide (PubChem CID 59079460) has the molecular formula C12H10N2O4S and a molecular weight of 278.29 g/mol. Its IUPAC name is 4-(4-nitrophenyl)benzenesulfonamide.
| Compound Name | 4'-Nitro[1,1'-biphenyl]-4-sulfonamide |
|---|---|
| PubChem CID | 59079460 |
| Molecular Formula | C12H10N2O4S |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 4-(4-nitrophenyl)benzenesulfonamide |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)S(=O)(=O)N)[N+](=O)[O-] |
| InChI | InChI=1S/C12H10N2O4S/c13-19(17,18)12-7-3-10(4-8-12)9-1-5-11(6-2-9)14(15)16/h1-8H,(H2,13,17,18) |
| InChIKey | MBLDYEXWNFSKAI-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 114.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | 410 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|