C33H23F6NOS — CID 59080062
(4-ethenylphenyl)-[3-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-1-benzothiophen-3-yl)cyclopenten-1-yl]-1,2-dimethylindol-6-yl]methanone (PubChem CID 59080062) has the molecular formula C33H23F6NOS and a molecular weight of 595.61 g/mol. Its IUPAC name is (4-ethenylphenyl)-[3-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-1-benzothiophen-3-yl)cyclopenten-1-yl]-1,2-dimethylindol-6-yl]methanone.
| Compound Name | (4-ethenylphenyl)-[3-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-1-benzothiophen-3-yl)cyclopenten-1-yl]-1,2-dimethylindol-6-yl]methanone |
|---|---|
| PubChem CID | 59080062 |
| Molecular Formula | C33H23F6NOS |
| Molecular Weight | 595.61 g/mol |
| Exact Mass | 595.14 |
| IUPAC Name | (4-ethenylphenyl)-[3-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-1-benzothiophen-3-yl)cyclopenten-1-yl]-1,2-dimethylindol-6-yl]methanone |
| SMILES | C=Cc1ccc(C(=O)c2ccc3c(C4=C(c5c(C)sc6ccccc56)C(F)(F)C(F)(F)C4(F)F)c(C)n(C)c3c2)cc1 |
| InChI | InChI=1S/C33H23F6NOS/c1-5-19-10-12-20(13-11-19)30(41)21-14-15-22-24(16-21)40(4)17(2)26(22)28-29(32(36,37)33(38,39)31(28,34)35)27-18(3)42-25-9-7-6-8-23(25)27/h5-16H,1H2,2-4H3 |
| InChIKey | WEXXTPFKDFQDAC-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.61 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|