C25H17F6NOS — CID 59080070
3-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-1-benzothiophen-3-yl)cyclopenten-1-yl]-1,2-dimethylindole-6-carbaldehyde (PubChem CID 59080070) has the molecular formula C25H17F6NOS and a molecular weight of 493.47 g/mol. Its IUPAC name is 3-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-1-benzothiophen-3-yl)cyclopenten-1-yl]-1,2-dimethylindole-6-carbaldehyde.
| Compound Name | 3-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-1-benzothiophen-3-yl)cyclopenten-1-yl]-1,2-dimethylindole-6-carbaldehyde |
|---|---|
| PubChem CID | 59080070 |
| Molecular Formula | C25H17F6NOS |
| Molecular Weight | 493.47 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | 3-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-1-benzothiophen-3-yl)cyclopenten-1-yl]-1,2-dimethylindole-6-carbaldehyde |
| SMILES | Cc1sc2ccccc2c1C1=C(c2c(C)n(C)c3cc(C=O)ccc23)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C25H17F6NOS/c1-12-19(15-9-8-14(11-33)10-17(15)32(12)3)21-22(24(28,29)25(30,31)23(21,26)27)20-13(2)34-18-7-5-4-6-16(18)20/h4-11H,1-3H3 |
| InChIKey | XTJZCSDOXSKEDO-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.47 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|