C16H28O3 — CID 59080629
(2S,3S,4R,5R)-3-methoxy-5-methyl-2-[(E)-6-methylhept-2-en-2-yl]-4-tritiooxycyclohexan-1-one (PubChem CID 59080629) has the molecular formula C16H28O3 and a molecular weight of 270.41 g/mol. Its IUPAC name is (2S,3S,4R,5R)-3-methoxy-5-methyl-2-[(E)-6-methylhept-2-en-2-yl]-4-tritiooxycyclohexan-1-one.
| Compound Name | (2S,3S,4R,5R)-3-methoxy-5-methyl-2-[(E)-6-methylhept-2-en-2-yl]-4-tritiooxycyclohexan-1-one |
|---|---|
| PubChem CID | 59080629 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | (2S,3S,4R,5R)-3-methoxy-5-methyl-2-[(E)-6-methylhept-2-en-2-yl]-4-tritiooxycyclohexan-1-one |
| SMILES | [3H]O[C@H]1[C@@H](OC)[C@H](/C(C)=C/CCC(C)C)C(=O)C[C@H]1C |
| InChI | InChI=1S/C16H28O3/c1-10(2)7-6-8-11(3)14-13(17)9-12(4)15(18)16(14)19-5/h8,10,12,14-16,18H,6-7,9H2,1-5H3/b11-8+/t12-,14-,15-,16+/m1/s1/i18T |
| InChIKey | XDGLPBCGFZUMTM-DLKKQUJASA-N |
| XLogP | 2.97 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|