C17H30O3 — CID 59080631
(3R,4S,5S,6R,7R)-5-methoxy-7-methyl-4-[(E)-6-methylhept-2-en-2-yl]-6-tritiooxy-1-oxaspiro[2.5]octane (PubChem CID 59080631) has the molecular formula C17H30O3 and a molecular weight of 284.43 g/mol. Its IUPAC name is (3R,4S,5S,6R,7R)-5-methoxy-7-methyl-4-[(E)-6-methylhept-2-en-2-yl]-6-tritiooxy-1-oxaspiro[2.5]octane.
| Compound Name | (3R,4S,5S,6R,7R)-5-methoxy-7-methyl-4-[(E)-6-methylhept-2-en-2-yl]-6-tritiooxy-1-oxaspiro[2.5]octane |
|---|---|
| PubChem CID | 59080631 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | (3R,4S,5S,6R,7R)-5-methoxy-7-methyl-4-[(E)-6-methylhept-2-en-2-yl]-6-tritiooxy-1-oxaspiro[2.5]octane |
| SMILES | [3H]O[C@@H]1[C@H](C)C[C@]2(CO2)C(/C(C)=C/CCC(C)C)[C@@H]1OC |
| InChI | InChI=1S/C17H30O3/c1-11(2)7-6-8-12(3)14-16(19-5)15(18)13(4)9-17(14)10-20-17/h8,11,13-16,18H,6-7,9-10H2,1-5H3/b12-8+/t13-,14?,15-,16+,17+/m1/s1/i18T |
| InChIKey | KJLVTISIDQFTPT-CDTMDSRUSA-N |
| XLogP | 3.17 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|