C17H30O3 — CID 59080633
(2S,3S,4R,5R)-5-ethyl-4-hydroxy-3-methoxy-2-[(E)-6-methylhept-2-en-2-yl]cyclohexan-1-one (PubChem CID 59080633) has the molecular formula C17H30O3 and a molecular weight of 282.42 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-ethyl-4-hydroxy-3-methoxy-2-[(E)-6-methylhept-2-en-2-yl]cyclohexan-1-one.
| Compound Name | (2S,3S,4R,5R)-5-ethyl-4-hydroxy-3-methoxy-2-[(E)-6-methylhept-2-en-2-yl]cyclohexan-1-one |
|---|---|
| PubChem CID | 59080633 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | (2S,3S,4R,5R)-5-ethyl-4-hydroxy-3-methoxy-2-[(E)-6-methylhept-2-en-2-yl]cyclohexan-1-one |
| SMILES | CC[C@@H]1CC(=O)[C@@H](/C(C)=C/CCC(C)C)[C@H](OC)[C@@H]1O |
| InChI | InChI=1S/C17H30O3/c1-6-13-10-14(18)15(17(20-5)16(13)19)12(4)9-7-8-11(2)3/h9,11,13,15-17,19H,6-8,10H2,1-5H3/b12-9+/t13-,15-,16-,17+/m1/s1 |
| InChIKey | IRHGYEAETSDSDA-JSLOBTPXSA-N |
| XLogP | 3.36 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|