C8H11F — CID 59080652
(1R,5R,6R)-6-fluoro-2,6-dimethylbicyclo[3.1.0]hex-2-ene (PubChem CID 59080652) has the molecular formula C8H11F and a molecular weight of 126.17 g/mol. Its IUPAC name is (1R,5R,6R)-6-fluoro-2,6-dimethylbicyclo[3.1.0]hex-2-ene.
| Compound Name | (1R,5R,6R)-6-fluoro-2,6-dimethylbicyclo[3.1.0]hex-2-ene |
|---|---|
| PubChem CID | 59080652 |
| Molecular Formula | C8H11F |
| Molecular Weight | 126.17 g/mol |
| Exact Mass | 126.08 |
| IUPAC Name | (1R,5R,6R)-6-fluoro-2,6-dimethylbicyclo[3.1.0]hex-2-ene |
| SMILES | CC1=CC[C@@H]2[C@H]1[C@]2(C)F |
| InChI | InChI=1S/C8H11F/c1-5-3-4-6-7(5)8(6,2)9/h3,6-7H,4H2,1-2H3/t6-,7+,8-/m1/s1 |
| InChIKey | MGELYVNRKUBEKK-GJMOJQLCSA-N |
| XLogP | 2.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.17 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|