C6H2F4O3S2 — CID 59081809
2,3,5,6-tetrafluoro-4-sulfanylbenzenesulfonic acid (PubChem CID 59081809) has the molecular formula C6H2F4O3S2 and a molecular weight of 262.20 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-sulfanylbenzenesulfonic acid.
| Compound Name | 2,3,5,6-tetrafluoro-4-sulfanylbenzenesulfonic acid |
|---|---|
| PubChem CID | 59081809 |
| Molecular Formula | C6H2F4O3S2 |
| Molecular Weight | 262.20 g/mol |
| Exact Mass | 261.94 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-sulfanylbenzenesulfonic acid |
| SMILES | O=S(=O)(O)c1c(F)c(F)c(S)c(F)c1F |
| InChI | InChI=1S/C6H2F4O3S2/c7-1-3(9)6(15(11,12)13)4(10)2(8)5(1)14/h14H,(H,11,12,13) |
| InChIKey | RWGDCDGKQNECLV-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.20 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|