C19H28N2O3 — CID 59082338
(2S)-2-ethyl-4-heptyl-3-oxo-2,5-dihydro-1H-1,4-benzodiazepine-7-carboxylic acid (PubChem CID 59082338) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is (2S)-2-ethyl-4-heptyl-3-oxo-2,5-dihydro-1H-1,4-benzodiazepine-7-carboxylic acid.
| Compound Name | (2S)-2-ethyl-4-heptyl-3-oxo-2,5-dihydro-1H-1,4-benzodiazepine-7-carboxylic acid |
|---|---|
| PubChem CID | 59082338 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | (2S)-2-ethyl-4-heptyl-3-oxo-2,5-dihydro-1H-1,4-benzodiazepine-7-carboxylic acid |
| SMILES | CCCCCCCN1Cc2cc(C(=O)O)ccc2N[C@@H](CC)C1=O |
| InChI | InChI=1S/C19H28N2O3/c1-3-5-6-7-8-11-21-13-15-12-14(19(23)24)9-10-17(15)20-16(4-2)18(21)22/h9-10,12,16,20H,3-8,11,13H2,1-2H3,(H,23,24)/t16-/m0/s1 |
| InChIKey | AXSGVMBIKDYRGV-INIZCTEOSA-N |
| XLogP | 3.89 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|