About 5-ethynylperoxy-1,2,3-tripropylbenzene
5-ethynylperoxy-1,2,3-tripropylbenzene (PubChem CID 59082423) has the molecular formula C17H24O2
and a molecular weight of 260.38 g/mol. Its IUPAC name is 5-ethynylperoxy-1,2,3-tripropylbenzene.
Molecular Properties
| Compound Name | 5-ethynylperoxy-1,2,3-tripropylbenzene |
| PubChem CID | 59082423 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | 5-ethynylperoxy-1,2,3-tripropylbenzene |
| SMILES | C#COOc1cc(CCC)c(CCC)c(CCC)c1 |
| InChI | InChI=1S/C17H24O2/c1-5-9-14-12-16(19-18-8-4)13-15(10-6-2)17(14)11-7-3/h4,12-13H,5-7,9-11H2,1-3H3 |
| InChIKey | YEKDKBCGOLFJEG-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-ethynylperoxy-1,2,3-tripropylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethynylperoxy-1,2,3-tripropylbenzene?
The IUPAC name of 5-ethynylperoxy-1,2,3-tripropylbenzene (CID 59082423) is 5-ethynylperoxy-1,2,3-tripropylbenzene.
What is the SMILES notation for 5-ethynylperoxy-1,2,3-tripropylbenzene?
The canonical SMILES for 5-ethynylperoxy-1,2,3-tripropylbenzene is C#COOc1cc(CCC)c(CCC)c(CCC)c1.
What is the InChIKey of 5-ethynylperoxy-1,2,3-tripropylbenzene?
The InChIKey is YEKDKBCGOLFJEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24O2/c1-5-9-14-12-16(19-18-8-4)13-15(10-6-2)17(14)11-7-3/h4,12-13H,5-7,9-11H2,1-3H3.
What are the key properties of 5-ethynylperoxy-1,2,3-tripropylbenzene?
5-ethynylperoxy-1,2,3-tripropylbenzene has a molecular weight of 260.38 g/mol, XLogP of 4.45, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethynylperoxy-1,2,3-tripropylbenzene is sourced from PubChem (CID 59082423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).