About (3-methyl-2,5-dioxopyrrolidin-1-yl) 4-[4-(2,5-dioxopyrrol-1-yl)cyclohexyl]butanoate
(3-methyl-2,5-dioxopyrrolidin-1-yl) 4-[4-(2,5-dioxopyrrol-1-yl)cyclohexyl]butanoate (PubChem CID 59082720) has the molecular formula C19H24N2O6
and a molecular weight of 376.41 g/mol. Its IUPAC name is (3-methyl-2,5-dioxopyrrolidin-1-yl) 4-[4-(2,5-dioxopyrrol-1-yl)cyclohexyl]butanoate.
Molecular Properties
| Compound Name | (3-methyl-2,5-dioxopyrrolidin-1-yl) 4-[4-(2,5-dioxopyrrol-1-yl)cyclohexyl]butanoate |
| PubChem CID | 59082720 |
| Molecular Formula | C19H24N2O6 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | (3-methyl-2,5-dioxopyrrolidin-1-yl) 4-[4-(2,5-dioxopyrrol-1-yl)cyclohexyl]butanoate |
| SMILES | CC1CC(=O)N(OC(=O)CCCC2CCC(N3C(=O)C=CC3=O)CC2)C1=O |
| InChI | InChI=1S/C19H24N2O6/c1-12-11-17(24)21(19(12)26)27-18(25)4-2-3-13-5-7-14(8-6-13)20-15(22)9-10-16(20)23/h9-10,12-14H,2-8,11H2,1H3 |
| InChIKey | MNDMTJCZIWPQLI-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (3-methyl-2,5-dioxopyrrolidin-1-yl) 4-[4-(2,5-dioxopyrrol-1-yl)cyclohexyl]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-2,5-dioxopyrrolidin-1-yl) 4-[4-(2,5-dioxopyrrol-1-yl)cyclohexyl]butanoate?
The IUPAC name of (3-methyl-2,5-dioxopyrrolidin-1-yl) 4-[4-(2,5-dioxopyrrol-1-yl)cyclohexyl]butanoate (CID 59082720) is (3-methyl-2,5-dioxopyrrolidin-1-yl) 4-[4-(2,5-dioxopyrrol-1-yl)cyclohexyl]butanoate.
What is the SMILES notation for (3-methyl-2,5-dioxopyrrolidin-1-yl) 4-[4-(2,5-dioxopyrrol-1-yl)cyclohexyl]butanoate?
The canonical SMILES for (3-methyl-2,5-dioxopyrrolidin-1-yl) 4-[4-(2,5-dioxopyrrol-1-yl)cyclohexyl]butanoate is CC1CC(=O)N(OC(=O)CCCC2CCC(N3C(=O)C=CC3=O)CC2)C1=O.
What is the InChIKey of (3-methyl-2,5-dioxopyrrolidin-1-yl) 4-[4-(2,5-dioxopyrrol-1-yl)cyclohexyl]butanoate?
The InChIKey is MNDMTJCZIWPQLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N2O6/c1-12-11-17(24)21(19(12)26)27-18(25)4-2-3-13-5-7-14(8-6-13)20-15(22)9-10-16(20)23/h9-10,12-14H,2-8,11H2,1H3.
What are the key properties of (3-methyl-2,5-dioxopyrrolidin-1-yl) 4-[4-(2,5-dioxopyrrol-1-yl)cyclohexyl]butanoate?
(3-methyl-2,5-dioxopyrrolidin-1-yl) 4-[4-(2,5-dioxopyrrol-1-yl)cyclohexyl]butanoate has a molecular weight of 376.41 g/mol, XLogP of 1.49, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-2,5-dioxopyrrolidin-1-yl) 4-[4-(2,5-dioxopyrrol-1-yl)cyclohexyl]butanoate is sourced from PubChem (CID 59082720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).