C11H23NO4 — CID 59083597
(E,2R,3S,4S,5S)-5-[ethyl(methyl)amino]oct-6-ene-1,2,3,4-tetrol (PubChem CID 59083597) has the molecular formula C11H23NO4 and a molecular weight of 233.31 g/mol. Its IUPAC name is (E,2R,3S,4S,5S)-5-[ethyl(methyl)amino]oct-6-ene-1,2,3,4-tetrol.
| Compound Name | (E,2R,3S,4S,5S)-5-[ethyl(methyl)amino]oct-6-ene-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 59083597 |
| Molecular Formula | C11H23NO4 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | (E,2R,3S,4S,5S)-5-[ethyl(methyl)amino]oct-6-ene-1,2,3,4-tetrol |
| SMILES | C/C=C/[C@@H]([C@H](O)[C@H](O)[C@H](O)CO)N(C)CC |
| InChI | InChI=1S/C11H23NO4/c1-4-6-8(12(3)5-2)10(15)11(16)9(14)7-13/h4,6,8-11,13-16H,5,7H2,1-3H3/b6-4+/t8-,9+,10-,11+/m0/s1 |
| InChIKey | KEURFUKGRBHCHY-ULXDUHAISA-N |
| XLogP | -1.04 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|