About 2-(6-methyl-3-pyridinyl)-5,6,7,8-tetrahydroquinoline
2-(6-methyl-3-pyridinyl)-5,6,7,8-tetrahydroquinoline (PubChem CID 59083944) has the molecular formula C15H16N2
and a molecular weight of 224.31 g/mol. Its IUPAC name is 2-(6-methyl-3-pyridinyl)-5,6,7,8-tetrahydroquinoline.
Molecular Properties
| Compound Name | 2-(6-methyl-3-pyridinyl)-5,6,7,8-tetrahydroquinoline |
| PubChem CID | 59083944 |
| Molecular Formula | C15H16N2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 2-(6-methyl-3-pyridinyl)-5,6,7,8-tetrahydroquinoline |
| SMILES | Cc1ccc(-c2ccc3c(n2)CCCC3)cn1 |
| InChI | InChI=1S/C15H16N2/c1-11-6-7-13(10-16-11)15-9-8-12-4-2-3-5-14(12)17-15/h6-10H,2-5H2,1H3 |
| InChIKey | RAYWIDCQKIAACG-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(6-methyl-3-pyridinyl)-5,6,7,8-tetrahydroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-methyl-3-pyridinyl)-5,6,7,8-tetrahydroquinoline?
The IUPAC name of 2-(6-methyl-3-pyridinyl)-5,6,7,8-tetrahydroquinoline (CID 59083944) is 2-(6-methyl-3-pyridinyl)-5,6,7,8-tetrahydroquinoline.
What is the SMILES notation for 2-(6-methyl-3-pyridinyl)-5,6,7,8-tetrahydroquinoline?
The canonical SMILES for 2-(6-methyl-3-pyridinyl)-5,6,7,8-tetrahydroquinoline is Cc1ccc(-c2ccc3c(n2)CCCC3)cn1.
What is the InChIKey of 2-(6-methyl-3-pyridinyl)-5,6,7,8-tetrahydroquinoline?
The InChIKey is RAYWIDCQKIAACG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2/c1-11-6-7-13(10-16-11)15-9-8-12-4-2-3-5-14(12)17-15/h6-10H,2-5H2,1H3.
What are the key properties of 2-(6-methyl-3-pyridinyl)-5,6,7,8-tetrahydroquinoline?
2-(6-methyl-3-pyridinyl)-5,6,7,8-tetrahydroquinoline has a molecular weight of 224.31 g/mol, XLogP of 3.33, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-methyl-3-pyridinyl)-5,6,7,8-tetrahydroquinoline is sourced from PubChem (CID 59083944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).