C18H32P+ — CID 59084045
trimethyl-[(2E,4E,6E)-3,7,11-trimethyldodeca-2,4,6,10-tetraenyl]phosphanium (PubChem CID 59084045) has the molecular formula C18H32P+ and a molecular weight of 279.43 g/mol. Its IUPAC name is trimethyl-[(2E,4E,6E)-3,7,11-trimethyldodeca-2,4,6,10-tetraenyl]phosphanium.
| Compound Name | trimethyl-[(2E,4E,6E)-3,7,11-trimethyldodeca-2,4,6,10-tetraenyl]phosphanium |
|---|---|
| PubChem CID | 59084045 |
| Molecular Formula | C18H32P+ |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | trimethyl-[(2E,4E,6E)-3,7,11-trimethyldodeca-2,4,6,10-tetraenyl]phosphanium |
| SMILES | CC(C)=CCC/C(C)=C/C=C/C(C)=C/C[P+](C)(C)C |
| InChI | InChI=1S/C18H32P/c1-16(2)10-8-11-17(3)12-9-13-18(4)14-15-19(5,6)7/h9-10,12-14H,8,11,15H2,1-7H3/q+1/b13-9+,17-12+,18-14+ |
| InChIKey | PUXOAWALYYIXFR-DGZDCGEPSA-N |
| XLogP | 6.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|