C20H32N2O5 — CID 59084489
methyl (1S,4R,14S,18S)-18-hydroxy-14-methyl-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadecane-4-carboxylate (PubChem CID 59084489) has the molecular formula C20H32N2O5 and a molecular weight of 380.49 g/mol. Its IUPAC name is methyl (1S,4R,14S,18S)-18-hydroxy-14-methyl-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadecane-4-carboxylate.
| Compound Name | methyl (1S,4R,14S,18S)-18-hydroxy-14-methyl-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadecane-4-carboxylate |
|---|---|
| PubChem CID | 59084489 |
| Molecular Formula | C20H32N2O5 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | methyl (1S,4R,14S,18S)-18-hydroxy-14-methyl-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadecane-4-carboxylate |
| SMILES | COC(=O)[C@@]12CC1CCCCCCC[C@H](C)C(=O)N1C[C@@H](O)C[C@H]1C(=O)N2 |
| InChI | InChI=1S/C20H32N2O5/c1-13-8-6-4-3-5-7-9-14-11-20(14,19(26)27-2)21-17(24)16-10-15(23)12-22(16)18(13)25/h13-16,23H,3-12H2,1-2H3,(H,21,24)/t13-,14?,15-,16-,20+/m0/s1 |
| InChIKey | ZBDKWCRXDOFTFK-LNSSONMFSA-N |
| XLogP | 1.38 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |