About (3R)-N-ethyl-2,5-dimethylhexan-3-amine
(3R)-N-ethyl-2,5-dimethylhexan-3-amine (PubChem CID 59084835) has the molecular formula C10H23N
and a molecular weight of 157.30 g/mol. Its IUPAC name is (3R)-N-ethyl-2,5-dimethylhexan-3-amine.
Molecular Properties
| Compound Name | (3R)-N-ethyl-2,5-dimethylhexan-3-amine |
| PubChem CID | 59084835 |
| Molecular Formula | C10H23N |
| Molecular Weight | 157.30 g/mol |
| Exact Mass | 157.18 |
| IUPAC Name | (3R)-N-ethyl-2,5-dimethylhexan-3-amine |
| SMILES | CCN[C@H](CC(C)C)C(C)C |
| InChI | InChI=1S/C10H23N/c1-6-11-10(9(4)5)7-8(2)3/h8-11H,6-7H2,1-5H3/t10-/m1/s1 |
| InChIKey | DUPLXRBKXXZTTM-SNVBAGLBSA-N |
| XLogP | 2.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3R)-N-ethyl-2,5-dimethylhexan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-N-ethyl-2,5-dimethylhexan-3-amine?
The IUPAC name of (3R)-N-ethyl-2,5-dimethylhexan-3-amine (CID 59084835) is (3R)-N-ethyl-2,5-dimethylhexan-3-amine.
What is the SMILES notation for (3R)-N-ethyl-2,5-dimethylhexan-3-amine?
The canonical SMILES for (3R)-N-ethyl-2,5-dimethylhexan-3-amine is CCN[C@H](CC(C)C)C(C)C.
What is the InChIKey of (3R)-N-ethyl-2,5-dimethylhexan-3-amine?
The InChIKey is DUPLXRBKXXZTTM-SNVBAGLBSA-N. The full InChI is InChI=1S/C10H23N/c1-6-11-10(9(4)5)7-8(2)3/h8-11H,6-7H2,1-5H3/t10-/m1/s1.
What are the key properties of (3R)-N-ethyl-2,5-dimethylhexan-3-amine?
(3R)-N-ethyl-2,5-dimethylhexan-3-amine has a molecular weight of 157.30 g/mol, XLogP of 2.67, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-N-ethyl-2,5-dimethylhexan-3-amine is sourced from PubChem (CID 59084835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).