C21H18F6N2O6 — CID 59085098
4-[2-[4-(dihydroxymethyl)-3-(methylcarbamoyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-(methylcarbamoyl)benzoic acid (PubChem CID 59085098) has the molecular formula C21H18F6N2O6 and a molecular weight of 508.37 g/mol. Its IUPAC name is 4-[2-[4-(dihydroxymethyl)-3-(methylcarbamoyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-(methylcarbamoyl)benzoic acid.
| Compound Name | 4-[2-[4-(dihydroxymethyl)-3-(methylcarbamoyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-(methylcarbamoyl)benzoic acid |
|---|---|
| PubChem CID | 59085098 |
| Molecular Formula | C21H18F6N2O6 |
| Molecular Weight | 508.37 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | 4-[2-[4-(dihydroxymethyl)-3-(methylcarbamoyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-(methylcarbamoyl)benzoic acid |
| SMILES | CNC(=O)c1cc(C(c2ccc(C(O)O)c(C(=O)NC)c2)(C(F)(F)F)C(F)(F)F)ccc1C(=O)O |
| InChI | InChI=1S/C21H18F6N2O6/c1-28-15(30)13-7-9(3-5-11(13)17(32)33)19(20(22,23)24,21(25,26)27)10-4-6-12(18(34)35)14(8-10)16(31)29-2/h3-8,17,32-33H,1-2H3,(H,28,30)(H,29,31)(H,34,35) |
| InChIKey | KUVWLOUKKXTEBZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 135.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|