C11H17N5O2 — CID 59085380
N-(9-ethyl-6-oxo-4,5-dihydro-1H-purin-2-yl)-2-methylpropanamide (PubChem CID 59085380) has the molecular formula C11H17N5O2 and a molecular weight of 251.29 g/mol. Its IUPAC name is N-(9-ethyl-6-oxo-4,5-dihydro-1H-purin-2-yl)-2-methylpropanamide.
| Compound Name | N-(9-ethyl-6-oxo-4,5-dihydro-1H-purin-2-yl)-2-methylpropanamide |
|---|---|
| PubChem CID | 59085380 |
| Molecular Formula | C11H17N5O2 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | N-(9-ethyl-6-oxo-4,5-dihydro-1H-purin-2-yl)-2-methylpropanamide |
| SMILES | CCN1C=NC2C(=O)NC(NC(=O)C(C)C)=NC21 |
| InChI | InChI=1S/C11H17N5O2/c1-4-16-5-12-7-8(16)13-11(15-10(7)18)14-9(17)6(2)3/h5-8H,4H2,1-3H3,(H2,13,14,15,17,18) |
| InChIKey | YLIADBKSUWTTPK-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 86.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |