About N-(9-ethyl-6-oxo-4,5-dihydro-1H-purin-2-yl)-2-methylpropanamide
N-(9-ethyl-6-oxo-4,5-dihydro-1H-purin-2-yl)-2-methylpropanamide (PubChem CID 59085380) has the molecular formula C11H17N5O2
and a molecular weight of 251.29 g/mol. Its IUPAC name is N-(9-ethyl-6-oxo-4,5-dihydro-1H-purin-2-yl)-2-methylpropanamide.
Molecular Properties
| Compound Name | N-(9-ethyl-6-oxo-4,5-dihydro-1H-purin-2-yl)-2-methylpropanamide |
| PubChem CID | 59085380 |
| Molecular Formula | C11H17N5O2 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | N-(9-ethyl-6-oxo-4,5-dihydro-1H-purin-2-yl)-2-methylpropanamide |
| SMILES | CCN1C=NC2C(=O)NC(NC(=O)C(C)C)=NC21 |
| InChI | InChI=1S/C11H17N5O2/c1-4-16-5-12-7-8(16)13-11(15-10(7)18)14-9(17)6(2)3/h5-8H,4H2,1-3H3,(H2,13,14,15,17,18) |
| InChIKey | YLIADBKSUWTTPK-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 86.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(9-ethyl-6-oxo-4,5-dihydro-1H-purin-2-yl)-2-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(9-ethyl-6-oxo-4,5-dihydro-1H-purin-2-yl)-2-methylpropanamide?
The IUPAC name of N-(9-ethyl-6-oxo-4,5-dihydro-1H-purin-2-yl)-2-methylpropanamide (CID 59085380) is N-(9-ethyl-6-oxo-4,5-dihydro-1H-purin-2-yl)-2-methylpropanamide.
What is the SMILES notation for N-(9-ethyl-6-oxo-4,5-dihydro-1H-purin-2-yl)-2-methylpropanamide?
The canonical SMILES for N-(9-ethyl-6-oxo-4,5-dihydro-1H-purin-2-yl)-2-methylpropanamide is CCN1C=NC2C(=O)NC(NC(=O)C(C)C)=NC21.
What is the InChIKey of N-(9-ethyl-6-oxo-4,5-dihydro-1H-purin-2-yl)-2-methylpropanamide?
The InChIKey is YLIADBKSUWTTPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N5O2/c1-4-16-5-12-7-8(16)13-11(15-10(7)18)14-9(17)6(2)3/h5-8H,4H2,1-3H3,(H2,13,14,15,17,18).
What are the key properties of N-(9-ethyl-6-oxo-4,5-dihydro-1H-purin-2-yl)-2-methylpropanamide?
N-(9-ethyl-6-oxo-4,5-dihydro-1H-purin-2-yl)-2-methylpropanamide has a molecular weight of 251.29 g/mol, XLogP of -0.70, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(9-ethyl-6-oxo-4,5-dihydro-1H-purin-2-yl)-2-methylpropanamide is sourced from PubChem (CID 59085380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).