C25H30O3 — CID 59086352
(5R)-16-ethoxy-5,13-dimethyl-8-oxopentacyclo[10.8.0.02,9.05,9.013,18]icosa-1(12),2,16,18-tetraene-19-carbaldehyde (PubChem CID 59086352) has the molecular formula C25H30O3 and a molecular weight of 378.51 g/mol. Its IUPAC name is (5R)-16-ethoxy-5,13-dimethyl-8-oxopentacyclo[10.8.0.02,9.05,9.013,18]icosa-1(12),2,16,18-tetraene-19-carbaldehyde.
| Compound Name | (5R)-16-ethoxy-5,13-dimethyl-8-oxopentacyclo[10.8.0.02,9.05,9.013,18]icosa-1(12),2,16,18-tetraene-19-carbaldehyde |
|---|---|
| PubChem CID | 59086352 |
| Molecular Formula | C25H30O3 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | (5R)-16-ethoxy-5,13-dimethyl-8-oxopentacyclo[10.8.0.02,9.05,9.013,18]icosa-1(12),2,16,18-tetraene-19-carbaldehyde |
| SMILES | CCOC1=CC2=C(C=O)CC3=C(CCC45C(=O)CC[C@]4(C)CC=C35)C2(C)CC1 |
| InChI | InChI=1S/C25H30O3/c1-4-28-17-5-11-24(3)19-7-12-25-20(6-9-23(25,2)10-8-22(25)27)18(19)13-16(15-26)21(24)14-17/h6,14-15H,4-5,7-13H2,1-3H3/t23-,24?,25?/m0/s1 |
| InChIKey | UEKKHTKXKPAZDB-KAVZGVEFSA-N |
| XLogP | 5.38 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|