C23H38N2O3 — CID 59086542
2,6-bis[[(2S)-2-(2-hydroxypropan-2-yl)pyrrolidin-1-yl]methyl]-4-methylphenol (PubChem CID 59086542) has the molecular formula C23H38N2O3 and a molecular weight of 390.57 g/mol. Its IUPAC name is 2,6-bis[[(2S)-2-(2-hydroxypropan-2-yl)pyrrolidin-1-yl]methyl]-4-methylphenol.
| Compound Name | 2,6-bis[[(2S)-2-(2-hydroxypropan-2-yl)pyrrolidin-1-yl]methyl]-4-methylphenol |
|---|---|
| PubChem CID | 59086542 |
| Molecular Formula | C23H38N2O3 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.29 |
| IUPAC Name | 2,6-bis[[(2S)-2-(2-hydroxypropan-2-yl)pyrrolidin-1-yl]methyl]-4-methylphenol |
| SMILES | Cc1cc(CN2CCC[C@H]2C(C)(C)O)c(O)c(CN2CCC[C@H]2C(C)(C)O)c1 |
| InChI | InChI=1S/C23H38N2O3/c1-16-12-17(14-24-10-6-8-19(24)22(2,3)27)21(26)18(13-16)15-25-11-7-9-20(25)23(4,5)28/h12-13,19-20,26-28H,6-11,14-15H2,1-5H3/t19-,20-/m0/s1 |
| InChIKey | WBLZTBHQUJNBDM-PMACEKPBSA-N |
| XLogP | 3.17 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|