C12H20O3 — CID 59086594
(2E,4E,6E)-8,8-dimethoxy-3,7-dimethylocta-2,4,6-trien-1-ol (PubChem CID 59086594) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is (2E,4E,6E)-8,8-dimethoxy-3,7-dimethylocta-2,4,6-trien-1-ol.
| Compound Name | (2E,4E,6E)-8,8-dimethoxy-3,7-dimethylocta-2,4,6-trien-1-ol |
|---|---|
| PubChem CID | 59086594 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | (2E,4E,6E)-8,8-dimethoxy-3,7-dimethylocta-2,4,6-trien-1-ol |
| SMILES | COC(OC)/C(C)=C/C=C/C(C)=C/CO |
| InChI | InChI=1S/C12H20O3/c1-10(8-9-13)6-5-7-11(2)12(14-3)15-4/h5-8,12-13H,9H2,1-4H3/b6-5+,10-8+,11-7+ |
| InChIKey | MLRDPSWBNBQBHF-DDUXJWAXSA-N |
| XLogP | 2.05 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|