C22H16Cl3N3O3 — CID 59086655
2,5-dimethyl-3-[3-[5-methyl-3-oxo-2-(2,4,6-trichlorophenyl)-1H-pyrazol-4-yl]prop-2-enylidene]-4,6-dioxocyclohexene-1-carbonitrile (PubChem CID 59086655) has the molecular formula C22H16Cl3N3O3 and a molecular weight of 476.75 g/mol. Its IUPAC name is 2,5-dimethyl-3-[3-[5-methyl-3-oxo-2-(2,4,6-trichlorophenyl)-1H-pyrazol-4-yl]prop-2-enylidene]-4,6-dioxocyclohexene-1-carbonitrile.
| Compound Name | 2,5-dimethyl-3-[3-[5-methyl-3-oxo-2-(2,4,6-trichlorophenyl)-1H-pyrazol-4-yl]prop-2-enylidene]-4,6-dioxocyclohexene-1-carbonitrile |
|---|---|
| PubChem CID | 59086655 |
| Molecular Formula | C22H16Cl3N3O3 |
| Molecular Weight | 476.75 g/mol |
| Exact Mass | 475.03 |
| IUPAC Name | 2,5-dimethyl-3-[3-[5-methyl-3-oxo-2-(2,4,6-trichlorophenyl)-1H-pyrazol-4-yl]prop-2-enylidene]-4,6-dioxocyclohexene-1-carbonitrile |
| SMILES | CC1=C(C#N)C(=O)C(C)C(=O)C1=CC=Cc1c(C)[nH]n(-c2c(Cl)cc(Cl)cc2Cl)c1=O |
| InChI | InChI=1S/C22H16Cl3N3O3/c1-10-14(20(29)11(2)21(30)16(10)9-26)5-4-6-15-12(3)27-28(22(15)31)19-17(24)7-13(23)8-18(19)25/h4-8,11,27H,1-3H3 |
| InChIKey | LMHJDCRQRCZWRY-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 95.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.75 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|