C44H35Cl2N — CID 59086831
N-[2,2-bis(4-chlorophenyl)ethenyl]-4-(4,4-diphenylbuta-1,3-dienyl)-3-methyl-N-(3-methylphenyl)aniline (PubChem CID 59086831) has the molecular formula C44H35Cl2N and a molecular weight of 648.68 g/mol. Its IUPAC name is N-[2,2-bis(4-chlorophenyl)ethenyl]-4-(4,4-diphenylbuta-1,3-dienyl)-3-methyl-N-(3-methylphenyl)aniline.
| Compound Name | N-[2,2-bis(4-chlorophenyl)ethenyl]-4-(4,4-diphenylbuta-1,3-dienyl)-3-methyl-N-(3-methylphenyl)aniline |
|---|---|
| PubChem CID | 59086831 |
| Molecular Formula | C44H35Cl2N |
| Molecular Weight | 648.68 g/mol |
| Exact Mass | 647.21 |
| IUPAC Name | N-[2,2-bis(4-chlorophenyl)ethenyl]-4-(4,4-diphenylbuta-1,3-dienyl)-3-methyl-N-(3-methylphenyl)aniline |
| SMILES | Cc1cccc(N(C=C(c2ccc(Cl)cc2)c2ccc(Cl)cc2)c2ccc(C=CC=C(c3ccccc3)c3ccccc3)c(C)c2)c1 |
| InChI | InChI=1S/C44H35Cl2N/c1-32-11-9-17-41(29-32)47(31-44(37-19-24-39(45)25-20-37)38-21-26-40(46)27-22-38)42-28-23-34(33(2)30-42)16-10-18-43(35-12-5-3-6-13-35)36-14-7-4-8-15-36/h3-31H,1-2H3 |
| InChIKey | MOKXWQKJQRWQCT-UHFFFAOYSA-N |
| XLogP | 12.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.68 |
| LogP ≤ 5 | 12.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|