About CID 59087081
CID 59087081 (PubChem CID 59087081) has the molecular formula C27H36BFN10O5PS2+
and a molecular weight of 705.57 g/mol.
Molecular Properties
| Compound Name | CID 59087081 |
| PubChem CID | 59087081 |
| Molecular Formula | C27H36BFN10O5PS2+ |
| Molecular Weight | 705.57 g/mol |
| Exact Mass | 705.21 |
| IUPAC Name | — |
| SMILES | [B]P(C)OC(=O)C1=C(C[n+]2cccc(N(C)CCCN(C)C)c2N=CC)CSC2C(NC(=O)/C(=N\OCF)c3nsc(N)n3)C(=O)N12 |
| InChI | InChI=1S/C27H35BFN10O5PS2/c1-6-31-22-17(37(4)11-8-10-36(2)3)9-7-12-38(22)13-16-14-46-25-19(24(41)39(25)20(16)26(42)44-45(5)28)32-23(40)18(34-43-15-29)21-33-27(30)47-35-21/h6-7,9,12,19,25H,8,10-11,13-15H2,1-5H3,(H2-,30,32,33,35,40)/p+1/b34-18- |
| InChIKey | SYBCZNUGABXHDY-HQDYHJHZSA-O |
| XLogP | 1.17 |
| TPSA | 171.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 705.57 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 59087081 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59087081?
The IUPAC name of CID 59087081 (CID 59087081) is not available.
What is the SMILES notation for CID 59087081?
The canonical SMILES for CID 59087081 is [B]P(C)OC(=O)C1=C(C[n+]2cccc(N(C)CCCN(C)C)c2N=CC)CSC2C(NC(=O)/C(=N\OCF)c3nsc(N)n3)C(=O)N12.
What is the InChIKey of CID 59087081?
The InChIKey is SYBCZNUGABXHDY-HQDYHJHZSA-O. The full InChI is InChI=1S/C27H35BFN10O5PS2/c1-6-31-22-17(37(4)11-8-10-36(2)3)9-7-12-38(22)13-16-14-46-25-19(24(41)39(25)20(16)26(42)44-45(5)28)32-23(40)18(34-43-15-29)21-33-27(30)47-35-21/h6-7,9,12,19,25H,8,10-11,13-15H2,1-5H3,(H2-,30,32,33,35,40)/p+1/b34-18-.
What are the key properties of CID 59087081?
CID 59087081 has a molecular weight of 705.57 g/mol, XLogP of 1.17, 15 rotatable bonds, 2 hydrogen bond donors, and 14 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59087081 is sourced from PubChem (CID 59087081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).