About 3-methyl-4-phenyl-1,2-dihydrotriazol-5-ol
3-methyl-4-phenyl-1,2-dihydrotriazol-5-ol (PubChem CID 59087111) has the molecular formula C9H11N3O
and a molecular weight of 177.21 g/mol. Its IUPAC name is 3-methyl-4-phenyl-1,2-dihydrotriazol-5-ol.
Molecular Properties
| Compound Name | 3-methyl-4-phenyl-1,2-dihydrotriazol-5-ol |
| PubChem CID | 59087111 |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | 3-methyl-4-phenyl-1,2-dihydrotriazol-5-ol |
| SMILES | CN1NNC(O)=C1c1ccccc1 |
| InChI | InChI=1S/C9H11N3O/c1-12-8(9(13)10-11-12)7-5-3-2-4-6-7/h2-6,10-11,13H,1H3 |
| InChIKey | XFKPPWVELRRJPB-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methyl-4-phenyl-1,2-dihydrotriazol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-4-phenyl-1,2-dihydrotriazol-5-ol?
The IUPAC name of 3-methyl-4-phenyl-1,2-dihydrotriazol-5-ol (CID 59087111) is 3-methyl-4-phenyl-1,2-dihydrotriazol-5-ol.
What is the SMILES notation for 3-methyl-4-phenyl-1,2-dihydrotriazol-5-ol?
The canonical SMILES for 3-methyl-4-phenyl-1,2-dihydrotriazol-5-ol is CN1NNC(O)=C1c1ccccc1.
What is the InChIKey of 3-methyl-4-phenyl-1,2-dihydrotriazol-5-ol?
The InChIKey is XFKPPWVELRRJPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O/c1-12-8(9(13)10-11-12)7-5-3-2-4-6-7/h2-6,10-11,13H,1H3.
What are the key properties of 3-methyl-4-phenyl-1,2-dihydrotriazol-5-ol?
3-methyl-4-phenyl-1,2-dihydrotriazol-5-ol has a molecular weight of 177.21 g/mol, XLogP of 0.83, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4-phenyl-1,2-dihydrotriazol-5-ol is sourced from PubChem (CID 59087111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).