C26H22F2N8O6 — CID 59087244
1-N-[[(3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-3,6-difluoro-2-N-(1-oxo-2,3-dihydroisoindol-4-yl)benzene-1,2-dicarboxamide (PubChem CID 59087244) has the molecular formula C26H22F2N8O6 and a molecular weight of 580.51 g/mol. Its IUPAC name is 1-N-[[(3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-3,6-difluoro-2-N-(1-oxo-2,3-dihydroisoindol-4-yl)benzene-1,2-dicarboxamide.
| Compound Name | 1-N-[[(3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-3,6-difluoro-2-N-(1-oxo-2,3-dihydroisoindol-4-yl)benzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 59087244 |
| Molecular Formula | C26H22F2N8O6 |
| Molecular Weight | 580.51 g/mol |
| Exact Mass | 580.16 |
| IUPAC Name | 1-N-[[(3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-3,6-difluoro-2-N-(1-oxo-2,3-dihydroisoindol-4-yl)benzene-1,2-dicarboxamide |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1OC(CNC(=O)c2c(F)ccc(F)c2C(=O)Nc2cccc3c2CNC3=O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C26H22F2N8O6/c27-12-4-5-13(28)17(25(41)35-14-3-1-2-10-11(14)6-30-23(10)39)16(12)24(40)31-7-15-19(37)20(38)26(42-15)36-9-34-18-21(29)32-8-33-22(18)36/h1-5,8-9,15,19-20,26,37-38H,6-7H2,(H,30,39)(H,31,40)(H,35,41)(H2,29,32,33)/t15?,19-,20-,26-/m1/s1 |
| InChIKey | JQGXQFPUFPVENG-CEHDMWKYSA-N |
| XLogP | 0.23 |
| TPSA | 206.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.51 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |