About (4-acetyl-2,6-ditert-butylphenyl) 3-tert-butyl-4-hydroxy-5-(2-methylprop-1-enyl)benzoate
(4-acetyl-2,6-ditert-butylphenyl) 3-tert-butyl-4-hydroxy-5-(2-methylprop-1-enyl)benzoate (PubChem CID 59087309) has the molecular formula C31H42O4
and a molecular weight of 478.67 g/mol. Its IUPAC name is (4-acetyl-2,6-ditert-butylphenyl) 3-tert-butyl-4-hydroxy-5-(2-methylprop-1-enyl)benzoate.
Molecular Properties
| Compound Name | (4-acetyl-2,6-ditert-butylphenyl) 3-tert-butyl-4-hydroxy-5-(2-methylprop-1-enyl)benzoate |
| PubChem CID | 59087309 |
| Molecular Formula | C31H42O4 |
| Molecular Weight | 478.67 g/mol |
| Exact Mass | 478.31 |
| IUPAC Name | (4-acetyl-2,6-ditert-butylphenyl) 3-tert-butyl-4-hydroxy-5-(2-methylprop-1-enyl)benzoate |
| SMILES | CC(=O)c1cc(C(C)(C)C)c(OC(=O)c2cc(C=C(C)C)c(O)c(C(C)(C)C)c2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C31H42O4/c1-18(2)13-21-14-22(17-23(26(21)33)29(4,5)6)28(34)35-27-24(30(7,8)9)15-20(19(3)32)16-25(27)31(10,11)12/h13-17,33H,1-12H3 |
| InChIKey | ORKICSGQKKYQMP-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 478.67 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-acetyl-2,6-ditert-butylphenyl) 3-tert-butyl-4-hydroxy-5-(2-methylprop-1-enyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-acetyl-2,6-ditert-butylphenyl) 3-tert-butyl-4-hydroxy-5-(2-methylprop-1-enyl)benzoate?
The IUPAC name of (4-acetyl-2,6-ditert-butylphenyl) 3-tert-butyl-4-hydroxy-5-(2-methylprop-1-enyl)benzoate (CID 59087309) is (4-acetyl-2,6-ditert-butylphenyl) 3-tert-butyl-4-hydroxy-5-(2-methylprop-1-enyl)benzoate.
What is the SMILES notation for (4-acetyl-2,6-ditert-butylphenyl) 3-tert-butyl-4-hydroxy-5-(2-methylprop-1-enyl)benzoate?
The canonical SMILES for (4-acetyl-2,6-ditert-butylphenyl) 3-tert-butyl-4-hydroxy-5-(2-methylprop-1-enyl)benzoate is CC(=O)c1cc(C(C)(C)C)c(OC(=O)c2cc(C=C(C)C)c(O)c(C(C)(C)C)c2)c(C(C)(C)C)c1.
What is the InChIKey of (4-acetyl-2,6-ditert-butylphenyl) 3-tert-butyl-4-hydroxy-5-(2-methylprop-1-enyl)benzoate?
The InChIKey is ORKICSGQKKYQMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H42O4/c1-18(2)13-21-14-22(17-23(26(21)33)29(4,5)6)28(34)35-27-24(30(7,8)9)15-20(19(3)32)16-25(27)31(10,11)12/h13-17,33H,1-12H3.
What are the key properties of (4-acetyl-2,6-ditert-butylphenyl) 3-tert-butyl-4-hydroxy-5-(2-methylprop-1-enyl)benzoate?
(4-acetyl-2,6-ditert-butylphenyl) 3-tert-butyl-4-hydroxy-5-(2-methylprop-1-enyl)benzoate has a molecular weight of 478.67 g/mol, XLogP of 8.13, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-acetyl-2,6-ditert-butylphenyl) 3-tert-butyl-4-hydroxy-5-(2-methylprop-1-enyl)benzoate is sourced from PubChem (CID 59087309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).