C13H28BO4P3 — CID 59087590
(3aR,4R,5R,6aS)-5-bis(phosphanyl)boranyloxy-4-[(3R)-3-phosphanyloxyhexyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol (PubChem CID 59087590) has the molecular formula C13H28BO4P3 and a molecular weight of 352.10 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-5-bis(phosphanyl)boranyloxy-4-[(3R)-3-phosphanyloxyhexyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol.
| Compound Name | (3aR,4R,5R,6aS)-5-bis(phosphanyl)boranyloxy-4-[(3R)-3-phosphanyloxyhexyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol |
|---|---|
| PubChem CID | 59087590 |
| Molecular Formula | C13H28BO4P3 |
| Molecular Weight | 352.10 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | (3aR,4R,5R,6aS)-5-bis(phosphanyl)boranyloxy-4-[(3R)-3-phosphanyloxyhexyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol |
| SMILES | CCC[C@H](CC[C@@H]1[C@H]2CC(O)O[C@H]2C[C@H]1OB(P)P)OP |
| InChI | InChI=1S/C13H28BO4P3/c1-2-3-8(18-21)4-5-9-10-6-13(15)16-11(10)7-12(9)17-14(19)20/h8-13,15H,2-7,19-21H2,1H3/t8-,9-,10-,11+,12-,13?/m1/s1 |
| InChIKey | FYMIFZQVXLHXQR-QWBLNCPTSA-N |
| XLogP | 2.61 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.10 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|