C34H62O6 — CID 59087758
5-[(4R,5R)-6-ethyl-5-[(2S,4R,5R)-6-ethyl-5-[(2S,4S,5R)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy-3,4-dimethyloxan-2-yl]oxy-3,4-dimethyloxan-2-yl]-3-methylpentan-2-one (PubChem CID 59087758) has the molecular formula C34H62O6 and a molecular weight of 566.86 g/mol. Its IUPAC name is 5-[(4R,5R)-6-ethyl-5-[(2S,4R,5R)-6-ethyl-5-[(2S,4S,5R)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy-3,4-dimethyloxan-2-yl]oxy-3,4-dimethyloxan-2-yl]-3-methylpentan-2-one.
| Compound Name | 5-[(4R,5R)-6-ethyl-5-[(2S,4R,5R)-6-ethyl-5-[(2S,4S,5R)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy-3,4-dimethyloxan-2-yl]oxy-3,4-dimethyloxan-2-yl]-3-methylpentan-2-one |
|---|---|
| PubChem CID | 59087758 |
| Molecular Formula | C34H62O6 |
| Molecular Weight | 566.86 g/mol |
| Exact Mass | 566.45 |
| IUPAC Name | 5-[(4R,5R)-6-ethyl-5-[(2S,4R,5R)-6-ethyl-5-[(2S,4S,5R)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy-3,4-dimethyloxan-2-yl]oxy-3,4-dimethyloxan-2-yl]-3-methylpentan-2-one |
| SMILES | CCC1O[C@@H](O[C@H]2C(CC)O[C@@H](O[C@H]3C(CC)OC(CCC(C)C(C)=O)C(C)[C@H]3C)C(C)[C@H]2C)C(C)[C@@H](C)[C@H]1C |
| InChI | InChI=1S/C34H62O6/c1-13-27-20(6)19(5)24(10)33(37-27)40-32-23(9)25(11)34(38-29(32)15-3)39-31-22(8)21(7)30(36-28(31)14-2)17-16-18(4)26(12)35/h18-25,27-34H,13-17H2,1-12H3/t18?,19-,20+,21?,22+,23+,24?,25?,27?,28?,29?,30?,31+,32+,33-,34-/m0/s1 |
| InChIKey | PQTSMNUCNFCLQO-XYZXOAOASA-N |
| XLogP | 7.66 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.86 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |