About 2-fluoro-N-[(3S,4S)-4-hydroxy-5-oxohexan-3-yl]acetamide
2-fluoro-N-[(3S,4S)-4-hydroxy-5-oxohexan-3-yl]acetamide (PubChem CID 59087787) has the molecular formula C8H14FNO3
and a molecular weight of 191.20 g/mol. Its IUPAC name is 2-fluoro-N-[(3S,4S)-4-hydroxy-5-oxohexan-3-yl]acetamide.
Molecular Properties
| Compound Name | 2-fluoro-N-[(3S,4S)-4-hydroxy-5-oxohexan-3-yl]acetamide |
| PubChem CID | 59087787 |
| Molecular Formula | C8H14FNO3 |
| Molecular Weight | 191.20 g/mol |
| Exact Mass | 191.10 |
| IUPAC Name | 2-fluoro-N-[(3S,4S)-4-hydroxy-5-oxohexan-3-yl]acetamide |
| SMILES | CC[C@H](NC(=O)CF)[C@H](O)C(C)=O |
| InChI | InChI=1S/C8H14FNO3/c1-3-6(8(13)5(2)11)10-7(12)4-9/h6,8,13H,3-4H2,1-2H3,(H,10,12)/t6-,8+/m0/s1 |
| InChIKey | XRPGWAFLFPRIEK-POYBYMJQSA-N |
| XLogP | -0.20 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.20 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-fluoro-N-[(3S,4S)-4-hydroxy-5-oxohexan-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-N-[(3S,4S)-4-hydroxy-5-oxohexan-3-yl]acetamide?
The IUPAC name of 2-fluoro-N-[(3S,4S)-4-hydroxy-5-oxohexan-3-yl]acetamide (CID 59087787) is 2-fluoro-N-[(3S,4S)-4-hydroxy-5-oxohexan-3-yl]acetamide.
What is the SMILES notation for 2-fluoro-N-[(3S,4S)-4-hydroxy-5-oxohexan-3-yl]acetamide?
The canonical SMILES for 2-fluoro-N-[(3S,4S)-4-hydroxy-5-oxohexan-3-yl]acetamide is CC[C@H](NC(=O)CF)[C@H](O)C(C)=O.
What is the InChIKey of 2-fluoro-N-[(3S,4S)-4-hydroxy-5-oxohexan-3-yl]acetamide?
The InChIKey is XRPGWAFLFPRIEK-POYBYMJQSA-N. The full InChI is InChI=1S/C8H14FNO3/c1-3-6(8(13)5(2)11)10-7(12)4-9/h6,8,13H,3-4H2,1-2H3,(H,10,12)/t6-,8+/m0/s1.
What are the key properties of 2-fluoro-N-[(3S,4S)-4-hydroxy-5-oxohexan-3-yl]acetamide?
2-fluoro-N-[(3S,4S)-4-hydroxy-5-oxohexan-3-yl]acetamide has a molecular weight of 191.20 g/mol, XLogP of -0.20, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-N-[(3S,4S)-4-hydroxy-5-oxohexan-3-yl]acetamide is sourced from PubChem (CID 59087787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).