About CID 59087828
CID 59087828 (PubChem CID 59087828) has the molecular formula C14H29BN3O3P
and a molecular weight of 329.19 g/mol.
Molecular Properties
| Compound Name | CID 59087828 |
| PubChem CID | 59087828 |
| Molecular Formula | C14H29BN3O3P |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | — |
| SMILES | [B]P(C)O[C@H](CCCCCCC)CCOCC(CO)N=[N+]=[N-] |
| InChI | InChI=1S/C14H29BN3O3P/c1-3-4-5-6-7-8-14(21-22(2)15)9-10-20-12-13(11-19)17-18-16/h13-14,19H,3-12H2,1-2H3/t13?,14-,22?/m1/s1 |
| InChIKey | UNPDBXLCNJAGHS-BJCXIENYSA-N |
| XLogP | 3.92 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 59087828 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59087828?
The IUPAC name of CID 59087828 (CID 59087828) is not available.
What is the SMILES notation for CID 59087828?
The canonical SMILES for CID 59087828 is [B]P(C)O[C@H](CCCCCCC)CCOCC(CO)N=[N+]=[N-].
What is the InChIKey of CID 59087828?
The InChIKey is UNPDBXLCNJAGHS-BJCXIENYSA-N. The full InChI is InChI=1S/C14H29BN3O3P/c1-3-4-5-6-7-8-14(21-22(2)15)9-10-20-12-13(11-19)17-18-16/h13-14,19H,3-12H2,1-2H3/t13?,14-,22?/m1/s1.
What are the key properties of CID 59087828?
CID 59087828 has a molecular weight of 329.19 g/mol, XLogP of 3.92, 15 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59087828 is sourced from PubChem (CID 59087828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).