C11H15NO6P2 — CID 59088140
N-[2-(3,4-dimethyl-5-oxo-2H-furan-2-yl)-2-hydroxyethyl]-3,3-diphosphorosopropanamide (PubChem CID 59088140) has the molecular formula C11H15NO6P2 and a molecular weight of 319.19 g/mol. Its IUPAC name is N-[2-(3,4-dimethyl-5-oxo-2H-furan-2-yl)-2-hydroxyethyl]-3,3-diphosphorosopropanamide.
| Compound Name | N-[2-(3,4-dimethyl-5-oxo-2H-furan-2-yl)-2-hydroxyethyl]-3,3-diphosphorosopropanamide |
|---|---|
| PubChem CID | 59088140 |
| Molecular Formula | C11H15NO6P2 |
| Molecular Weight | 319.19 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | N-[2-(3,4-dimethyl-5-oxo-2H-furan-2-yl)-2-hydroxyethyl]-3,3-diphosphorosopropanamide |
| SMILES | CC1=C(C)C(C(O)CNC(=O)CC(P=O)P=O)OC1=O |
| InChI | InChI=1S/C11H15NO6P2/c1-5-6(2)11(15)18-10(5)7(13)4-12-8(14)3-9(19-16)20-17/h7,9-10,13H,3-4H2,1-2H3,(H,12,14) |
| InChIKey | NWSKLTGNQQMFIV-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.19 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|