C10H16O3Y — CID 59088459
[(3aR,6R)-2,2,6-trimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]methanol;yttrium (PubChem CID 59088459) has the molecular formula C10H16O3Y and a molecular weight of 273.14 g/mol. Its IUPAC name is [(3aR,6R)-2,2,6-trimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]methanol;yttrium.
| Compound Name | [(3aR,6R)-2,2,6-trimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]methanol;yttrium |
|---|---|
| PubChem CID | 59088459 |
| Molecular Formula | C10H16O3Y |
| Molecular Weight | 273.14 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | [(3aR,6R)-2,2,6-trimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]methanol;yttrium |
| SMILES | C[C@@H]1C=C(CO)[C@H]2OC(C)(C)OC12.[Y] |
| InChI | InChI=1S/C10H16O3.Y/c1-6-4-7(5-11)9-8(6)12-10(2,3)13-9;/h4,6,8-9,11H,5H2,1-3H3;/t6-,8?,9-;/m1./s1 |
| InChIKey | LJTRXCZZEQHNIY-LFVWUZGCSA-N |
| XLogP | 1.07 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.14 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|