C14H20O4Y — CID 59088461
(1S,3S,7R,8S)-1-(hydroxymethyl)-5,5-dimethyl-4,6-dioxatetracyclo[8.2.1.02,9.03,7]tridec-11-en-8-ol;yttrium (PubChem CID 59088461) has the molecular formula C14H20O4Y and a molecular weight of 341.22 g/mol. Its IUPAC name is (1S,3S,7R,8S)-1-(hydroxymethyl)-5,5-dimethyl-4,6-dioxatetracyclo[8.2.1.02,9.03,7]tridec-11-en-8-ol;yttrium.
| Compound Name | (1S,3S,7R,8S)-1-(hydroxymethyl)-5,5-dimethyl-4,6-dioxatetracyclo[8.2.1.02,9.03,7]tridec-11-en-8-ol;yttrium |
|---|---|
| PubChem CID | 59088461 |
| Molecular Formula | C14H20O4Y |
| Molecular Weight | 341.22 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | (1S,3S,7R,8S)-1-(hydroxymethyl)-5,5-dimethyl-4,6-dioxatetracyclo[8.2.1.02,9.03,7]tridec-11-en-8-ol;yttrium |
| SMILES | CC1(C)O[C@@H]2C(O)C3C4C=C[C@@](CO)(C4)C3[C@@H]2O1.[Y] |
| InChI | InChI=1S/C14H20O4.Y/c1-13(2)17-11-9-8(10(16)12(11)18-13)7-3-4-14(9,5-7)6-15;/h3-4,7-12,15-16H,5-6H2,1-2H3;/t7?,8?,9?,10?,11-,12+,14-;/m0./s1 |
| InChIKey | QRPYATMKOBPSRU-WHCKEIRISA-N |
| XLogP | 0.68 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.22 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|