C19H20N3O5PS — CID 59089007
2-[4-[(6-carbamoyl-1-methyl-4,5-dihydrothieno[3,4-g]indazol-8-yl)oxy]phenyl]ethylphosphonic acid (PubChem CID 59089007) has the molecular formula C19H20N3O5PS and a molecular weight of 433.43 g/mol. Its IUPAC name is 2-[4-[(6-carbamoyl-1-methyl-4,5-dihydrothieno[3,4-g]indazol-8-yl)oxy]phenyl]ethylphosphonic acid.
| Compound Name | 2-[4-[(6-carbamoyl-1-methyl-4,5-dihydrothieno[3,4-g]indazol-8-yl)oxy]phenyl]ethylphosphonic acid |
|---|---|
| PubChem CID | 59089007 |
| Molecular Formula | C19H20N3O5PS |
| Molecular Weight | 433.43 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | 2-[4-[(6-carbamoyl-1-methyl-4,5-dihydrothieno[3,4-g]indazol-8-yl)oxy]phenyl]ethylphosphonic acid |
| SMILES | Cn1ncc2c1-c1c(Oc3ccc(CCP(=O)(O)O)cc3)sc(C(N)=O)c1CC2 |
| InChI | InChI=1S/C19H20N3O5PS/c1-22-16-12(10-21-22)4-7-14-15(16)19(29-17(14)18(20)23)27-13-5-2-11(3-6-13)8-9-28(24,25)26/h2-3,5-6,10H,4,7-9H2,1H3,(H2,20,23)(H2,24,25,26) |
| InChIKey | MLKQMBPFMWMSKH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 127.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.43 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|