C18H15N3O3S — CID 59089023
8-(4-formylphenoxy)-1-methyl-4,5-dihydrothieno[3,4-g]indazole-6-carboxamide (PubChem CID 59089023) has the molecular formula C18H15N3O3S and a molecular weight of 353.40 g/mol. Its IUPAC name is 8-(4-formylphenoxy)-1-methyl-4,5-dihydrothieno[3,4-g]indazole-6-carboxamide.
| Compound Name | 8-(4-formylphenoxy)-1-methyl-4,5-dihydrothieno[3,4-g]indazole-6-carboxamide |
|---|---|
| PubChem CID | 59089023 |
| Molecular Formula | C18H15N3O3S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 8-(4-formylphenoxy)-1-methyl-4,5-dihydrothieno[3,4-g]indazole-6-carboxamide |
| SMILES | Cn1ncc2c1-c1c(Oc3ccc(C=O)cc3)sc(C(N)=O)c1CC2 |
| InChI | InChI=1S/C18H15N3O3S/c1-21-15-11(8-20-21)4-7-13-14(15)18(25-16(13)17(19)23)24-12-5-2-10(9-22)3-6-12/h2-3,5-6,8-9H,4,7H2,1H3,(H2,19,23) |
| InChIKey | VMAQVRIMMDGWLW-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|