About 1-methyl-8-[(5-morpholin-4-yl-3-pyridinyl)oxy]-4,5-dihydrothieno[3,4-g]indazole-6-carboxylic acid
1-methyl-8-[(5-morpholin-4-yl-3-pyridinyl)oxy]-4,5-dihydrothieno[3,4-g]indazole-6-carboxylic acid (PubChem CID 59089044) has the molecular formula C20H20N4O4S
and a molecular weight of 412.47 g/mol. Its IUPAC name is 1-methyl-8-[(5-morpholin-4-yl-3-pyridinyl)oxy]-4,5-dihydrothieno[3,4-g]indazole-6-carboxylic acid.
Molecular Properties
| Compound Name | 1-methyl-8-[(5-morpholin-4-yl-3-pyridinyl)oxy]-4,5-dihydrothieno[3,4-g]indazole-6-carboxylic acid |
| PubChem CID | 59089044 |
| Molecular Formula | C20H20N4O4S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 1-methyl-8-[(5-morpholin-4-yl-3-pyridinyl)oxy]-4,5-dihydrothieno[3,4-g]indazole-6-carboxylic acid |
| SMILES | Cn1ncc2c1-c1c(Oc3cncc(N4CCOCC4)c3)sc(C(=O)O)c1CC2 |
| InChI | InChI=1S/C20H20N4O4S/c1-23-17-12(9-22-23)2-3-15-16(17)20(29-18(15)19(25)26)28-14-8-13(10-21-11-14)24-4-6-27-7-5-24/h8-11H,2-7H2,1H3,(H,25,26) |
| InChIKey | HIYZWCIXBXCPJU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 1-methyl-8-[(5-morpholin-4-yl-3-pyridinyl)oxy]-4,5-dihydrothieno[3,4-g]indazole-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-8-[(5-morpholin-4-yl-3-pyridinyl)oxy]-4,5-dihydrothieno[3,4-g]indazole-6-carboxylic acid?
The IUPAC name of 1-methyl-8-[(5-morpholin-4-yl-3-pyridinyl)oxy]-4,5-dihydrothieno[3,4-g]indazole-6-carboxylic acid (CID 59089044) is 1-methyl-8-[(5-morpholin-4-yl-3-pyridinyl)oxy]-4,5-dihydrothieno[3,4-g]indazole-6-carboxylic acid.
What is the SMILES notation for 1-methyl-8-[(5-morpholin-4-yl-3-pyridinyl)oxy]-4,5-dihydrothieno[3,4-g]indazole-6-carboxylic acid?
The canonical SMILES for 1-methyl-8-[(5-morpholin-4-yl-3-pyridinyl)oxy]-4,5-dihydrothieno[3,4-g]indazole-6-carboxylic acid is Cn1ncc2c1-c1c(Oc3cncc(N4CCOCC4)c3)sc(C(=O)O)c1CC2.
What is the InChIKey of 1-methyl-8-[(5-morpholin-4-yl-3-pyridinyl)oxy]-4,5-dihydrothieno[3,4-g]indazole-6-carboxylic acid?
The InChIKey is HIYZWCIXBXCPJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N4O4S/c1-23-17-12(9-22-23)2-3-15-16(17)20(29-18(15)19(25)26)28-14-8-13(10-21-11-14)24-4-6-27-7-5-24/h8-11H,2-7H2,1H3,(H,25,26).
What are the key properties of 1-methyl-8-[(5-morpholin-4-yl-3-pyridinyl)oxy]-4,5-dihydrothieno[3,4-g]indazole-6-carboxylic acid?
1-methyl-8-[(5-morpholin-4-yl-3-pyridinyl)oxy]-4,5-dihydrothieno[3,4-g]indazole-6-carboxylic acid has a molecular weight of 412.47 g/mol, XLogP of 2.97, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-8-[(5-morpholin-4-yl-3-pyridinyl)oxy]-4,5-dihydrothieno[3,4-g]indazole-6-carboxylic acid is sourced from PubChem (CID 59089044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).