C16H15N4O3S+ — CID 59089067
8-(1-hydroxypyridin-1-ium-3-yl)oxy-1-methyl-4,5-dihydrothieno[3,4-g]indazole-6-carboxamide (PubChem CID 59089067) has the molecular formula C16H15N4O3S+ and a molecular weight of 343.39 g/mol. Its IUPAC name is 8-(1-hydroxypyridin-1-ium-3-yl)oxy-1-methyl-4,5-dihydrothieno[3,4-g]indazole-6-carboxamide.
| Compound Name | 8-(1-hydroxypyridin-1-ium-3-yl)oxy-1-methyl-4,5-dihydrothieno[3,4-g]indazole-6-carboxamide |
|---|---|
| PubChem CID | 59089067 |
| Molecular Formula | C16H15N4O3S+ |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 8-(1-hydroxypyridin-1-ium-3-yl)oxy-1-methyl-4,5-dihydrothieno[3,4-g]indazole-6-carboxamide |
| SMILES | Cn1ncc2c1-c1c(Oc3ccc[n+](O)c3)sc(C(N)=O)c1CC2 |
| InChI | InChI=1S/C16H14N4O3S/c1-19-13-9(7-18-19)4-5-11-12(13)16(24-14(11)15(17)21)23-10-3-2-6-20(22)8-10/h2-3,6-8H,4-5H2,1H3,(H2-,17,21,22)/p+1 |
| InChIKey | YLELDSBMXLOEAU-UHFFFAOYSA-O |
| XLogP | 1.66 |
| TPSA | 94.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|