C10H15F6N3O2 — CID 59089375
N-[3-[3-aminopropyl-(2,2,2-trifluoroacetyl)amino]propyl]-2,2,2-trifluoroacetamide (PubChem CID 59089375) has the molecular formula C10H15F6N3O2 and a molecular weight of 323.24 g/mol. Its IUPAC name is N-[3-[3-aminopropyl-(2,2,2-trifluoroacetyl)amino]propyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[3-[3-aminopropyl-(2,2,2-trifluoroacetyl)amino]propyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 59089375 |
| Molecular Formula | C10H15F6N3O2 |
| Molecular Weight | 323.24 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | N-[3-[3-aminopropyl-(2,2,2-trifluoroacetyl)amino]propyl]-2,2,2-trifluoroacetamide |
| SMILES | NCCCN(CCCNC(=O)C(F)(F)F)C(=O)C(F)(F)F |
| InChI | InChI=1S/C10H15F6N3O2/c11-9(12,13)7(20)18-4-2-6-19(5-1-3-17)8(21)10(14,15)16/h1-6,17H2,(H,18,20) |
| InChIKey | ZKINSUYXSBPUTA-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.24 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|