C19H14ClFN4O2S — CID 59089763
N-(5-chloro-2-pyridinyl)-3-[(4-ethanimidoyl-2-fluorobenzoyl)amino]thiophene-2-carboxamide (PubChem CID 59089763) has the molecular formula C19H14ClFN4O2S and a molecular weight of 416.87 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-3-[(4-ethanimidoyl-2-fluorobenzoyl)amino]thiophene-2-carboxamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-3-[(4-ethanimidoyl-2-fluorobenzoyl)amino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 59089763 |
| Molecular Formula | C19H14ClFN4O2S |
| Molecular Weight | 416.87 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-3-[(4-ethanimidoyl-2-fluorobenzoyl)amino]thiophene-2-carboxamide |
| SMILES | [H]/N=C(\C)c1ccc(C(=O)Nc2ccsc2C(=O)Nc2ccc(Cl)cn2)c(F)c1 |
| InChI | InChI=1S/C19H14ClFN4O2S/c1-10(22)11-2-4-13(14(21)8-11)18(26)24-15-6-7-28-17(15)19(27)25-16-5-3-12(20)9-23-16/h2-9,22H,1H3,(H,24,26)(H,23,25,27)/b22-10+ |
| InChIKey | CSZGGRCMNVYGBF-LSHDLFTRSA-N |
| XLogP | 4.83 |
| TPSA | 94.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.87 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|