C12H7F5N2O2S — CID 59089922
2,3,4,5,6-pentafluoro-N-(6-methyl-3-pyridinyl)benzenesulfonamide (PubChem CID 59089922) has the molecular formula C12H7F5N2O2S and a molecular weight of 338.26 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-(6-methyl-3-pyridinyl)benzenesulfonamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-(6-methyl-3-pyridinyl)benzenesulfonamide |
|---|---|
| PubChem CID | 59089922 |
| Molecular Formula | C12H7F5N2O2S |
| Molecular Weight | 338.26 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-(6-methyl-3-pyridinyl)benzenesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)cn1 |
| InChI | InChI=1S/C12H7F5N2O2S/c1-5-2-3-6(4-18-5)19-22(20,21)12-10(16)8(14)7(13)9(15)11(12)17/h2-4,19H,1H3 |
| InChIKey | BUDYETFBSWIVJC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.26 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|