About 5-bromoadamantan-2-one
5-bromoadamantan-2-one (PubChem CID 590905) has the molecular formula C10H13BrO
and a molecular weight of 229.12 g/mol. Its IUPAC name is 5-bromoadamantan-2-one.
Molecular Properties
| Compound Name | 5-bromoadamantan-2-one |
| PubChem CID | 590905 |
| Molecular Formula | C10H13BrO |
| Molecular Weight | 229.12 g/mol |
| Exact Mass | 228.01 |
| IUPAC Name | 5-bromoadamantan-2-one |
| SMILES | O=C1C2CC3CC1CC(Br)(C3)C2 |
| InChI | InChI=1S/C10H13BrO/c11-10-3-6-1-7(4-10)9(12)8(2-6)5-10/h6-8H,1-5H2 |
| InChIKey | TXEWIOREYPSNRR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.12 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-bromoadamantan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromoadamantan-2-one?
The IUPAC name of 5-bromoadamantan-2-one (CID 590905) is 5-bromoadamantan-2-one.
What is the SMILES notation for 5-bromoadamantan-2-one?
The canonical SMILES for 5-bromoadamantan-2-one is O=C1C2CC3CC1CC(Br)(C3)C2.
What is the InChIKey of 5-bromoadamantan-2-one?
The InChIKey is TXEWIOREYPSNRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13BrO/c11-10-3-6-1-7(4-10)9(12)8(2-6)5-10/h6-8H,1-5H2.
What are the key properties of 5-bromoadamantan-2-one?
5-bromoadamantan-2-one has a molecular weight of 229.12 g/mol, XLogP of 2.53, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromoadamantan-2-one is sourced from PubChem (CID 590905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).