About actinium;(2S)-2-[(1R,2R)-1-hydroxy-2-methylpent-4-enyl]-3-methylcyclopentan-1-one
actinium;(2S)-2-[(1R,2R)-1-hydroxy-2-methylpent-4-enyl]-3-methylcyclopentan-1-one (PubChem CID 59090545) has the molecular formula C12H20AcO2
and a molecular weight of 423.29 g/mol. Its IUPAC name is actinium;(2S)-2-[(1R,2R)-1-hydroxy-2-methylpent-4-enyl]-3-methylcyclopentan-1-one.
Molecular Properties
| Compound Name | actinium;(2S)-2-[(1R,2R)-1-hydroxy-2-methylpent-4-enyl]-3-methylcyclopentan-1-one |
| PubChem CID | 59090545 |
| Molecular Formula | C12H20AcO2 |
| Molecular Weight | 423.29 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | actinium;(2S)-2-[(1R,2R)-1-hydroxy-2-methylpent-4-enyl]-3-methylcyclopentan-1-one |
| SMILES | C=CC[C@@H](C)[C@@H](O)[C@H]1C(=O)CCC1C.[Ac] |
| InChI | InChI=1S/C12H20O2.Ac/c1-4-5-9(3)12(14)11-8(2)6-7-10(11)13;/h4,8-9,11-12,14H,1,5-7H2,2-3H3;/t8?,9-,11-,12-;/m1./s1 |
| InChIKey | RJDXAFPNKOHOIH-KIMYKSCWSA-N |
| XLogP | 2.17 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze actinium;(2S)-2-[(1R,2R)-1-hydroxy-2-methylpent-4-enyl]-3-methylcyclopentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of actinium;(2S)-2-[(1R,2R)-1-hydroxy-2-methylpent-4-enyl]-3-methylcyclopentan-1-one?
The IUPAC name of actinium;(2S)-2-[(1R,2R)-1-hydroxy-2-methylpent-4-enyl]-3-methylcyclopentan-1-one (CID 59090545) is actinium;(2S)-2-[(1R,2R)-1-hydroxy-2-methylpent-4-enyl]-3-methylcyclopentan-1-one.
What is the SMILES notation for actinium;(2S)-2-[(1R,2R)-1-hydroxy-2-methylpent-4-enyl]-3-methylcyclopentan-1-one?
The canonical SMILES for actinium;(2S)-2-[(1R,2R)-1-hydroxy-2-methylpent-4-enyl]-3-methylcyclopentan-1-one is C=CC[C@@H](C)[C@@H](O)[C@H]1C(=O)CCC1C.[Ac].
What is the InChIKey of actinium;(2S)-2-[(1R,2R)-1-hydroxy-2-methylpent-4-enyl]-3-methylcyclopentan-1-one?
The InChIKey is RJDXAFPNKOHOIH-KIMYKSCWSA-N. The full InChI is InChI=1S/C12H20O2.Ac/c1-4-5-9(3)12(14)11-8(2)6-7-10(11)13;/h4,8-9,11-12,14H,1,5-7H2,2-3H3;/t8?,9-,11-,12-;/m1./s1.
What are the key properties of actinium;(2S)-2-[(1R,2R)-1-hydroxy-2-methylpent-4-enyl]-3-methylcyclopentan-1-one?
actinium;(2S)-2-[(1R,2R)-1-hydroxy-2-methylpent-4-enyl]-3-methylcyclopentan-1-one has a molecular weight of 423.29 g/mol, XLogP of 2.17, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for actinium;(2S)-2-[(1R,2R)-1-hydroxy-2-methylpent-4-enyl]-3-methylcyclopentan-1-one is sourced from PubChem (CID 59090545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).