C26H26N5+ — CID 59092779
phenyl-[4-[5-(1,3,3-trimethylindol-1-ium-2-yl)-3,4-dihydropyrazol-2-yl]phenyl]diazene (PubChem CID 59092779) has the molecular formula C26H26N5+ and a molecular weight of 408.53 g/mol. Its IUPAC name is phenyl-[4-[5-(1,3,3-trimethylindol-1-ium-2-yl)-3,4-dihydropyrazol-2-yl]phenyl]diazene.
| Compound Name | phenyl-[4-[5-(1,3,3-trimethylindol-1-ium-2-yl)-3,4-dihydropyrazol-2-yl]phenyl]diazene |
|---|---|
| PubChem CID | 59092779 |
| Molecular Formula | C26H26N5+ |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | phenyl-[4-[5-(1,3,3-trimethylindol-1-ium-2-yl)-3,4-dihydropyrazol-2-yl]phenyl]diazene |
| SMILES | C[N+]1=C(C2=NN(c3ccc(/N=N/c4ccccc4)cc3)CC2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C26H26N5/c1-26(2)22-11-7-8-12-24(22)30(3)25(26)23-17-18-31(29-23)21-15-13-20(14-16-21)28-27-19-9-5-4-6-10-19/h4-16H,17-18H2,1-3H3/q+1/b28-27+ |
| InChIKey | PWJKHEQQFNNFKO-BYYHNAKLSA-N |
| XLogP | 6.37 |
| TPSA | 43.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|