About N-[2-[(1S,2S)-2-ethyl-2-methylcyclopropyl]ethyl]prop-1-en-2-amine
N-[2-[(1S,2S)-2-ethyl-2-methylcyclopropyl]ethyl]prop-1-en-2-amine (PubChem CID 59093097) has the molecular formula C11H21N
and a molecular weight of 167.30 g/mol. Its IUPAC name is N-[2-[(1S,2S)-2-ethyl-2-methylcyclopropyl]ethyl]prop-1-en-2-amine.
Molecular Properties
| Compound Name | N-[2-[(1S,2S)-2-ethyl-2-methylcyclopropyl]ethyl]prop-1-en-2-amine |
| PubChem CID | 59093097 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | N-[2-[(1S,2S)-2-ethyl-2-methylcyclopropyl]ethyl]prop-1-en-2-amine |
| SMILES | C=C(C)NCC[C@@H]1C[C@]1(C)CC |
| InChI | InChI=1S/C11H21N/c1-5-11(4)8-10(11)6-7-12-9(2)3/h10,12H,2,5-8H2,1,3-4H3/t10-,11+/m1/s1 |
| InChIKey | SGIZSQITVSUDQI-MNOVXSKESA-N |
| XLogP | 2.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[2-[(1S,2S)-2-ethyl-2-methylcyclopropyl]ethyl]prop-1-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(1S,2S)-2-ethyl-2-methylcyclopropyl]ethyl]prop-1-en-2-amine?
The IUPAC name of N-[2-[(1S,2S)-2-ethyl-2-methylcyclopropyl]ethyl]prop-1-en-2-amine (CID 59093097) is N-[2-[(1S,2S)-2-ethyl-2-methylcyclopropyl]ethyl]prop-1-en-2-amine.
What is the SMILES notation for N-[2-[(1S,2S)-2-ethyl-2-methylcyclopropyl]ethyl]prop-1-en-2-amine?
The canonical SMILES for N-[2-[(1S,2S)-2-ethyl-2-methylcyclopropyl]ethyl]prop-1-en-2-amine is C=C(C)NCC[C@@H]1C[C@]1(C)CC.
What is the InChIKey of N-[2-[(1S,2S)-2-ethyl-2-methylcyclopropyl]ethyl]prop-1-en-2-amine?
The InChIKey is SGIZSQITVSUDQI-MNOVXSKESA-N. The full InChI is InChI=1S/C11H21N/c1-5-11(4)8-10(11)6-7-12-9(2)3/h10,12H,2,5-8H2,1,3-4H3/t10-,11+/m1/s1.
What are the key properties of N-[2-[(1S,2S)-2-ethyl-2-methylcyclopropyl]ethyl]prop-1-en-2-amine?
N-[2-[(1S,2S)-2-ethyl-2-methylcyclopropyl]ethyl]prop-1-en-2-amine has a molecular weight of 167.30 g/mol, XLogP of 2.94, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(1S,2S)-2-ethyl-2-methylcyclopropyl]ethyl]prop-1-en-2-amine is sourced from PubChem (CID 59093097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).