About N-(2-acetamido-6-oxo-4,5-dihydro-1H-pyrimidin-5-yl)-3-amino-N-methylpropanamide
N-(2-acetamido-6-oxo-4,5-dihydro-1H-pyrimidin-5-yl)-3-amino-N-methylpropanamide (PubChem CID 59093099) has the molecular formula C10H17N5O3
and a molecular weight of 255.28 g/mol. Its IUPAC name is N-(2-acetamido-6-oxo-4,5-dihydro-1H-pyrimidin-5-yl)-3-amino-N-methylpropanamide.
Molecular Properties
| Compound Name | N-(2-acetamido-6-oxo-4,5-dihydro-1H-pyrimidin-5-yl)-3-amino-N-methylpropanamide |
| PubChem CID | 59093099 |
| Molecular Formula | C10H17N5O3 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | N-(2-acetamido-6-oxo-4,5-dihydro-1H-pyrimidin-5-yl)-3-amino-N-methylpropanamide |
| SMILES | CC(=O)NC1=NCC(N(C)C(=O)CCN)C(=O)N1 |
| InChI | InChI=1S/C10H17N5O3/c1-6(16)13-10-12-5-7(9(18)14-10)15(2)8(17)3-4-11/h7H,3-5,11H2,1-2H3,(H2,12,13,14,16,18) |
| InChIKey | FBFITTIJIBIBON-UHFFFAOYSA-N |
| XLogP | -2.22 |
| TPSA | 116.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(2-acetamido-6-oxo-4,5-dihydro-1H-pyrimidin-5-yl)-3-amino-N-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-acetamido-6-oxo-4,5-dihydro-1H-pyrimidin-5-yl)-3-amino-N-methylpropanamide?
The IUPAC name of N-(2-acetamido-6-oxo-4,5-dihydro-1H-pyrimidin-5-yl)-3-amino-N-methylpropanamide (CID 59093099) is N-(2-acetamido-6-oxo-4,5-dihydro-1H-pyrimidin-5-yl)-3-amino-N-methylpropanamide.
What is the SMILES notation for N-(2-acetamido-6-oxo-4,5-dihydro-1H-pyrimidin-5-yl)-3-amino-N-methylpropanamide?
The canonical SMILES for N-(2-acetamido-6-oxo-4,5-dihydro-1H-pyrimidin-5-yl)-3-amino-N-methylpropanamide is CC(=O)NC1=NCC(N(C)C(=O)CCN)C(=O)N1.
What is the InChIKey of N-(2-acetamido-6-oxo-4,5-dihydro-1H-pyrimidin-5-yl)-3-amino-N-methylpropanamide?
The InChIKey is FBFITTIJIBIBON-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N5O3/c1-6(16)13-10-12-5-7(9(18)14-10)15(2)8(17)3-4-11/h7H,3-5,11H2,1-2H3,(H2,12,13,14,16,18).
What are the key properties of N-(2-acetamido-6-oxo-4,5-dihydro-1H-pyrimidin-5-yl)-3-amino-N-methylpropanamide?
N-(2-acetamido-6-oxo-4,5-dihydro-1H-pyrimidin-5-yl)-3-amino-N-methylpropanamide has a molecular weight of 255.28 g/mol, XLogP of -2.22, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-acetamido-6-oxo-4,5-dihydro-1H-pyrimidin-5-yl)-3-amino-N-methylpropanamide is sourced from PubChem (CID 59093099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).