About 2-tert-butyl-2-phenyl-1,3-dioxolane
2-tert-butyl-2-phenyl-1,3-dioxolane (PubChem CID 590932) has the molecular formula C13H18O2
and a molecular weight of 206.28 g/mol. Its IUPAC name is 2-tert-butyl-2-phenyl-1,3-dioxolane.
Molecular Properties
| Compound Name | 2-tert-butyl-2-phenyl-1,3-dioxolane |
| PubChem CID | 590932 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 2-tert-butyl-2-phenyl-1,3-dioxolane |
| SMILES | CC(C)(C)C1(c2ccccc2)OCCO1 |
| InChI | InChI=1S/C13H18O2/c1-12(2,3)13(14-9-10-15-13)11-7-5-4-6-8-11/h4-8H,9-10H2,1-3H3 |
| InChIKey | DONCIWYKEJRZLE-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-tert-butyl-2-phenyl-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-2-phenyl-1,3-dioxolane?
The IUPAC name of 2-tert-butyl-2-phenyl-1,3-dioxolane (CID 590932) is 2-tert-butyl-2-phenyl-1,3-dioxolane.
What is the SMILES notation for 2-tert-butyl-2-phenyl-1,3-dioxolane?
The canonical SMILES for 2-tert-butyl-2-phenyl-1,3-dioxolane is CC(C)(C)C1(c2ccccc2)OCCO1.
What is the InChIKey of 2-tert-butyl-2-phenyl-1,3-dioxolane?
The InChIKey is DONCIWYKEJRZLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O2/c1-12(2,3)13(14-9-10-15-13)11-7-5-4-6-8-11/h4-8H,9-10H2,1-3H3.
What are the key properties of 2-tert-butyl-2-phenyl-1,3-dioxolane?
2-tert-butyl-2-phenyl-1,3-dioxolane has a molecular weight of 206.28 g/mol, XLogP of 2.93, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-2-phenyl-1,3-dioxolane is sourced from PubChem (CID 590932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).