C12H18N3O7+ — CID 59093811
[(2S)-3-[[2-[(4S)-4-(2-carboxyethyl)-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-2-methylpropanoyl]oxidanium (PubChem CID 59093811) has the molecular formula C12H18N3O7+ and a molecular weight of 316.29 g/mol. Its IUPAC name is [(2S)-3-[[2-[(4S)-4-(2-carboxyethyl)-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-2-methylpropanoyl]oxidanium.
| Compound Name | [(2S)-3-[[2-[(4S)-4-(2-carboxyethyl)-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-2-methylpropanoyl]oxidanium |
|---|---|
| PubChem CID | 59093811 |
| Molecular Formula | C12H18N3O7+ |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | [(2S)-3-[[2-[(4S)-4-(2-carboxyethyl)-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-2-methylpropanoyl]oxidanium |
| SMILES | C[C@@H](CNC(=O)CN1C(=O)N[C@@H](CCC(=O)O)C1=O)C(=O)[OH2+] |
| InChI | InChI=1S/C12H17N3O7/c1-6(11(20)21)4-13-8(16)5-15-10(19)7(14-12(15)22)2-3-9(17)18/h6-7H,2-5H2,1H3,(H,13,16)(H,14,22)(H,17,18)(H,20,21)/p+1/t6-,7-/m0/s1 |
| InChIKey | FOTFWPNQJNHHBZ-BQBZGAKWSA-O |
| XLogP | -2.22 |
| TPSA | 155.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|